About 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene
1-(2,4-dimethylphenyl)-3,5-diphenylbenzene (PubChem CID 20766179) has the molecular formula C26H22
and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene |
| PubChem CID | 20766179 |
| Molecular Formula | C26H22 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C26H22/c1-19-13-14-26(20(2)15-19)25-17-23(21-9-5-3-6-10-21)16-24(18-25)22-11-7-4-8-12-22/h3-18H,1-2H3 |
| InChIKey | VMJMFONHYDLRBJ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene?
The IUPAC name of 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene (CID 20766179) is 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene?
The canonical SMILES for 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene is Cc1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c(C)c1.
What is the InChIKey of 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene?
The InChIKey is VMJMFONHYDLRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22/c1-19-13-14-26(20(2)15-19)25-17-23(21-9-5-3-6-10-21)16-24(18-25)22-11-7-4-8-12-22/h3-18H,1-2H3.
What are the key properties of 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene?
1-(2,4-dimethylphenyl)-3,5-diphenylbenzene has a molecular weight of 334.46 g/mol, XLogP of 7.30, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-3,5-diphenylbenzene is sourced from PubChem (CID 20766179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).