C22H24N4O5S — CID 20766507
N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[(2-thiophen-2-ylacetyl)amino]propan-2-yl]oxamide (PubChem CID 20766507) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[(2-thiophen-2-ylacetyl)amino]propan-2-yl]oxamide.
| Compound Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[(2-thiophen-2-ylacetyl)amino]propan-2-yl]oxamide |
|---|---|
| PubChem CID | 20766507 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]-N'-[2-methyl-1-[(2-thiophen-2-ylacetyl)amino]propan-2-yl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CNC(=O)Cc2cccs2)ccc1-c1cnco1 |
| InChI | InChI=1S/C22H24N4O5S/c1-22(2,12-24-19(27)10-15-5-4-8-32-15)26-21(29)20(28)25-14-6-7-16(17(9-14)30-3)18-11-23-13-31-18/h4-9,11,13H,10,12H2,1-3H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | HUJKDAYMCUNDBW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|