C15H28O2 — CID 20767047
6-hydroxy-2,3,3,5,7-pentamethyldec-9-en-4-one (PubChem CID 20767047) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 6-hydroxy-2,3,3,5,7-pentamethyldec-9-en-4-one.
| Compound Name | 6-hydroxy-2,3,3,5,7-pentamethyldec-9-en-4-one |
|---|---|
| PubChem CID | 20767047 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 6-hydroxy-2,3,3,5,7-pentamethyldec-9-en-4-one |
| SMILES | C=CCC(C)C(O)C(C)C(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H28O2/c1-8-9-11(4)13(16)12(5)14(17)15(6,7)10(2)3/h8,10-13,16H,1,9H2,2-7H3 |
| InChIKey | RTTKIWQBHBAYSY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|