About 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine
2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine (PubChem CID 20767169) has the molecular formula C13H18OSi
and a molecular weight of 218.37 g/mol. Its IUPAC name is 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine.
Molecular Properties
| Compound Name | 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine |
| PubChem CID | 20767169 |
| Molecular Formula | C13H18OSi |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine |
| SMILES | C[Si]1(C)C=CCCC(c2ccccc2)O1 |
| InChI | InChI=1S/C13H18OSi/c1-15(2)11-7-6-10-13(14-15)12-8-4-3-5-9-12/h3-5,7-9,11,13H,6,10H2,1-2H3 |
| InChIKey | RUMQDNFIPBKIOX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine?
The IUPAC name of 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine (CID 20767169) is 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine.
What is the SMILES notation for 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine?
The canonical SMILES for 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine is C[Si]1(C)C=CCCC(c2ccccc2)O1.
What is the InChIKey of 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine?
The InChIKey is RUMQDNFIPBKIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18OSi/c1-15(2)11-7-6-10-13(14-15)12-8-4-3-5-9-12/h3-5,7-9,11,13H,6,10H2,1-2H3.
What are the key properties of 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine?
2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine has a molecular weight of 218.37 g/mol, XLogP of 3.84, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-7-phenyl-6,7-dihydro-5H-oxasilepine is sourced from PubChem (CID 20767169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).