C25H40O7 — CID 20767209
tert-butyl (4Z,8E)-2-acetyl-2-acetyloxy-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate (PubChem CID 20767209) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is tert-butyl (4Z,8E)-2-acetyl-2-acetyloxy-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate.
| Compound Name | tert-butyl (4Z,8E)-2-acetyl-2-acetyloxy-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate |
|---|---|
| PubChem CID | 20767209 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | tert-butyl (4Z,8E)-2-acetyl-2-acetyloxy-5,9-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienoate |
| SMILES | CC(=O)OC(C/C=C(/C)CC/C=C(\C)COC1CCCCO1)(C(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H40O7/c1-18(11-10-12-19(2)17-30-22-13-8-9-16-29-22)14-15-25(20(3)26,31-21(4)27)23(28)32-24(5,6)7/h12,14,22H,8-11,13,15-17H2,1-7H3/b18-14-,19-12+ |
| InChIKey | IRZNJSYJCAJSSN-OIJZVNQYSA-N |
| XLogP | 4.83 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|