About 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum
2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum (PubChem CID 20767235) has the molecular formula C17H22NO2Pt-
and a molecular weight of 467.45 g/mol. Its IUPAC name is 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum.
Molecular Properties
| Compound Name | 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum |
| PubChem CID | 20767235 |
| Molecular Formula | C17H22NO2Pt- |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum |
| SMILES | CC(O)CC(C)O.Cc1c[c-]c(-c2ccccn2)cc1.[Pt] |
| InChI | InChI=1S/C12H10N.C5H12O2.Pt/c1-10-5-7-11(8-6-10)12-4-2-3-9-13-12;1-4(6)3-5(2)7;/h2-7,9H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | AIDNQENAIPAGOJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum?
The IUPAC name of 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum (CID 20767235) is 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum.
What is the SMILES notation for 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum?
The canonical SMILES for 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum is CC(O)CC(C)O.Cc1c[c-]c(-c2ccccn2)cc1.[Pt].
What is the InChIKey of 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum?
The InChIKey is AIDNQENAIPAGOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N.C5H12O2.Pt/c1-10-5-7-11(8-6-10)12-4-2-3-9-13-12;1-4(6)3-5(2)7;/h2-7,9H,1H3;4-7H,3H2,1-2H3;/q-1;;.
What are the key properties of 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum?
2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum has a molecular weight of 467.45 g/mol, XLogP of 2.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylbenzene-6-id-1-yl)pyridine;pentane-2,4-diol;platinum is sourced from PubChem (CID 20767235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).