C25H22N4OS — CID 20767337
(2Z)-2-[2-[(E)-2-[2-(dimethylamino)-4-phenyl-1,3-thiazol-5-yl]ethenyl]-5,6,7,8-tetrahydrochromen-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 20767337) has the molecular formula C25H22N4OS and a molecular weight of 426.55 g/mol. Its IUPAC name is (2Z)-2-[2-[(E)-2-[2-(dimethylamino)-4-phenyl-1,3-thiazol-5-yl]ethenyl]-5,6,7,8-tetrahydrochromen-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[2-[(E)-2-[2-(dimethylamino)-4-phenyl-1,3-thiazol-5-yl]ethenyl]-5,6,7,8-tetrahydrochromen-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 20767337 |
| Molecular Formula | C25H22N4OS |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (2Z)-2-[2-[(E)-2-[2-(dimethylamino)-4-phenyl-1,3-thiazol-5-yl]ethenyl]-5,6,7,8-tetrahydrochromen-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/C=C(/C=C/c2sc(N(C)C)nc2-c2ccccc2)OC2=C1CCCC2 |
| InChI | InChI=1S/C25H22N4OS/c1-27-21(16-26)20-15-18(30-22-12-8-7-11-19(20)22)13-14-23-24(17-9-5-4-6-10-17)28-25(31-23)29(2)3/h4-6,9-10,13-15H,7-8,11-12H2,2-3H3/b14-13+,21-20- |
| InChIKey | GQNDUVCXALXHHS-RAEPVASNSA-N |
| XLogP | 6.33 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|