C58H50N4 — CID 20767452
N-[4-[2,3-dimethyl-5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]benzo[b]phenazin-12-yl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 20767452) has the molecular formula C58H50N4 and a molecular weight of 803.07 g/mol. Its IUPAC name is N-[4-[2,3-dimethyl-5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]benzo[b]phenazin-12-yl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[2,3-dimethyl-5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]benzo[b]phenazin-12-yl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 20767452 |
| Molecular Formula | C58H50N4 |
| Molecular Weight | 803.07 g/mol |
| Exact Mass | 802.40 |
| IUPAC Name | N-[4-[2,3-dimethyl-5-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]benzo[b]phenazin-12-yl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(N3c4cc(C)c(C)cc4N(c4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)cc4)c4cc5ccccc5cc43)cc2)cc1 |
| InChI | InChI=1S/C58H50N4/c1-39-11-19-47(20-12-39)59(48-21-13-40(2)14-22-48)51-27-31-53(32-28-51)61-55-35-43(5)44(6)36-56(55)62(58-38-46-10-8-7-9-45(46)37-57(58)61)54-33-29-52(30-34-54)60(49-23-15-41(3)16-24-49)50-25-17-42(4)18-26-50/h7-38H,1-6H3 |
| InChIKey | GGQREONKTPMZPT-UHFFFAOYSA-N |
| XLogP | 16.88 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.07 |
| LogP ≤ 5 | 16.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |