C27H22F6 — CID 20767473
1-[2-(4,5-dimethylnaphthalen-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4,5-dimethylnaphthalene (PubChem CID 20767473) has the molecular formula C27H22F6 and a molecular weight of 460.46 g/mol. Its IUPAC name is 1-[2-(4,5-dimethylnaphthalen-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4,5-dimethylnaphthalene.
| Compound Name | 1-[2-(4,5-dimethylnaphthalen-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4,5-dimethylnaphthalene |
|---|---|
| PubChem CID | 20767473 |
| Molecular Formula | C27H22F6 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-[2-(4,5-dimethylnaphthalen-2-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-4,5-dimethylnaphthalene |
| SMILES | Cc1cccc2cc(C(c3ccc(C)c4c(C)cccc34)(C(F)(F)F)C(F)(F)F)cc(C)c12 |
| InChI | InChI=1S/C27H22F6/c1-15-7-5-9-19-14-20(13-18(4)23(15)19)25(26(28,29)30,27(31,32)33)22-12-11-17(3)24-16(2)8-6-10-21(22)24/h5-14H,1-4H3 |
| InChIKey | GBWGPAJEFGGGNS-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |