C8H8Br2O2S — CID 20767480
2,3-bis(bromomethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 20767480) has the molecular formula C8H8Br2O2S and a molecular weight of 328.03 g/mol. Its IUPAC name is 2,3-bis(bromomethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 2,3-bis(bromomethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 20767480 |
| Molecular Formula | C8H8Br2O2S |
| Molecular Weight | 328.03 g/mol |
| Exact Mass | 325.86 |
| IUPAC Name | 2,3-bis(bromomethyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | BrCC1Oc2cscc2OC1CBr |
| InChI | InChI=1S/C8H8Br2O2S/c9-1-5-6(2-10)12-8-4-13-3-7(8)11-5/h3-6H,1-2H2 |
| InChIKey | UQKRUSMNTPHDMZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.03 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|