C12H16O2S5 — CID 20767485
5,7-dimethyl-3,9-dioxa-6,13,14,16,17-pentathiatricyclo[9.4.2.04,8]heptadeca-4,7-diene (PubChem CID 20767485) has the molecular formula C12H16O2S5 and a molecular weight of 352.59 g/mol. Its IUPAC name is 5,7-dimethyl-3,9-dioxa-6,13,14,16,17-pentathiatricyclo[9.4.2.04,8]heptadeca-4,7-diene.
| Compound Name | 5,7-dimethyl-3,9-dioxa-6,13,14,16,17-pentathiatricyclo[9.4.2.04,8]heptadeca-4,7-diene |
|---|---|
| PubChem CID | 20767485 |
| Molecular Formula | C12H16O2S5 |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 5,7-dimethyl-3,9-dioxa-6,13,14,16,17-pentathiatricyclo[9.4.2.04,8]heptadeca-4,7-diene |
| SMILES | Cc1sc(C)c2c1OCC1CSSCC(CO2)SS1 |
| InChI | InChI=1S/C12H16O2S5/c1-7-11-12(8(2)17-7)14-4-10-6-16-15-5-9(3-13-11)18-19-10/h9-10H,3-6H2,1-2H3 |
| InChIKey | ACFNOXINENAQRL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|