C16H14N4 — CID 20767724
N,12-dimethyl-14,15,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,13,16-octaen-16-amine (PubChem CID 20767724) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is N,12-dimethyl-14,15,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,13,16-octaen-16-amine.
| Compound Name | N,12-dimethyl-14,15,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,13,16-octaen-16-amine |
|---|---|
| PubChem CID | 20767724 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N,12-dimethyl-14,15,17-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,13,16-octaen-16-amine |
| SMILES | CNc1nc2cc3ccccc3cc2c2c(C)cnn12 |
| InChI | InChI=1S/C16H14N4/c1-10-9-18-20-15(10)13-7-11-5-3-4-6-12(11)8-14(13)19-16(20)17-2/h3-9H,1-2H3,(H,17,19) |
| InChIKey | MDTKQKJDAXYFCW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|