C21H27NO5 — CID 20768054
methyl 8-hydroxy-6-(2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 20768054) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl 8-hydroxy-6-(2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | methyl 8-hydroxy-6-(2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 20768054 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | methyl 8-hydroxy-6-(2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-5-oxo-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | COC(=O)C1CCN2C(=O)C(C(=O)C3C(C)C=CC4CCCCC43)=CC12O |
| InChI | InChI=1S/C21H27NO5/c1-12-7-8-13-5-3-4-6-14(13)17(12)18(23)15-11-21(26)16(20(25)27-2)9-10-22(21)19(15)24/h7-8,11-14,16-17,26H,3-6,9-10H2,1-2H3 |
| InChIKey | NTHJYPNNEVKRHS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|