C13H27NO — CID 20768153
4-methoxy-2,2,6,6-tetramethyl-1-propylpiperidine (PubChem CID 20768153) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 4-methoxy-2,2,6,6-tetramethyl-1-propylpiperidine.
| Compound Name | 4-methoxy-2,2,6,6-tetramethyl-1-propylpiperidine |
|---|---|
| PubChem CID | 20768153 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 4-methoxy-2,2,6,6-tetramethyl-1-propylpiperidine |
| SMILES | CCCN1C(C)(C)CC(OC)CC1(C)C |
| InChI | InChI=1S/C13H27NO/c1-7-8-14-12(2,3)9-11(15-6)10-13(14,4)5/h11H,7-10H2,1-6H3 |
| InChIKey | VZKFUURXAWUECX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |