C6H7N5O — CID 20768405
2-amino-8-methylimidazo[1,2-a][1,3,5]triazin-4-one (PubChem CID 20768405) has the molecular formula C6H7N5O and a molecular weight of 165.16 g/mol. Its IUPAC name is 2-amino-8-methylimidazo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 2-amino-8-methylimidazo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 20768405 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 2-amino-8-methylimidazo[1,2-a][1,3,5]triazin-4-one |
| SMILES | Cn1ccn2c(=O)nc(N)nc12 |
| InChI | InChI=1S/C6H7N5O/c1-10-2-3-11-5(10)8-4(7)9-6(11)12/h2-3H,1H3,(H2,7,9,12) |
| InChIKey | FJSXABTUKCOIGG-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |