C16H21F5 — CID 20768644
4,4-difluoro-5,9,10-trimethyl-5-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 20768644) has the molecular formula C16H21F5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 4,4-difluoro-5,9,10-trimethyl-5-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4,4-difluoro-5,9,10-trimethyl-5-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 20768644 |
| Molecular Formula | C16H21F5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 4,4-difluoro-5,9,10-trimethyl-5-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC1C(C)C2CC1C1C2C2CC1C(F)(F)C2(C)C(F)(F)F |
| InChI | InChI=1S/C16H21F5/c1-6-7(2)9-4-8(6)12-10-5-11(13(9)12)15(17,18)14(10,3)16(19,20)21/h6-13H,4-5H2,1-3H3 |
| InChIKey | WBDMBZMOGDCKKX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|