About 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one
6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one (PubChem CID 20768868) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one.
Analyze 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one?
The IUPAC name of 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one (CID 20768868) is 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one.
What is the SMILES notation for 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one?
The canonical SMILES for 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one is O=c1ccnc2n1CCCCS2.
What is the InChIKey of 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one?
The InChIKey is QSRYTJDQTBCGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c11-7-3-4-9-8-10(7)5-1-2-6-12-8/h3-4H,1-2,5-6H2.
What are the key properties of 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one?
6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one has a molecular weight of 182.25 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,8,9-tetrahydropyrimido[2,1-b][1,3]thiazepin-4-one is sourced from PubChem (CID 20768868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).