About propan-2-yl 2-methylprop-2-enoate
propan-2-yl 2-methylprop-2-enoate (PubChem CID 20769) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is propan-2-yl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl 2-methylprop-2-enoate |
| PubChem CID | 20769 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C |
| InChI | InChI=1S/C7H12O2/c1-5(2)7(8)9-6(3)4/h6H,1H2,2-4H3 |
| InChIKey | BOQSSGDQNWEFSX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-methylprop-2-enoate?
The IUPAC name of propan-2-yl 2-methylprop-2-enoate (CID 20769) is propan-2-yl 2-methylprop-2-enoate.
What is the SMILES notation for propan-2-yl 2-methylprop-2-enoate?
The canonical SMILES for propan-2-yl 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-methylprop-2-enoate?
The InChIKey is BOQSSGDQNWEFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-5(2)7(8)9-6(3)4/h6H,1H2,2-4H3.
What are the key properties of propan-2-yl 2-methylprop-2-enoate?
propan-2-yl 2-methylprop-2-enoate has a molecular weight of 128.17 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-methylprop-2-enoate is sourced from PubChem (CID 20769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).