C29H28N2O4 — CID 20769050
methyl 2-[[7-(3-amino-3-oxoprop-1-en-2-yl)-11-benzyl-1,2,3,4-tetrahydrobenzo[a]carbazol-6-yl]oxy]acetate (PubChem CID 20769050) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is methyl 2-[[7-(3-amino-3-oxoprop-1-en-2-yl)-11-benzyl-1,2,3,4-tetrahydrobenzo[a]carbazol-6-yl]oxy]acetate.
| Compound Name | methyl 2-[[7-(3-amino-3-oxoprop-1-en-2-yl)-11-benzyl-1,2,3,4-tetrahydrobenzo[a]carbazol-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 20769050 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | methyl 2-[[7-(3-amino-3-oxoprop-1-en-2-yl)-11-benzyl-1,2,3,4-tetrahydrobenzo[a]carbazol-6-yl]oxy]acetate |
| SMILES | C=C(C(N)=O)c1cccc2c1c1c(OCC(=O)OC)cc3c(c1n2Cc1ccccc1)CCCC3 |
| InChI | InChI=1S/C29H28N2O4/c1-18(29(30)33)21-13-8-14-23-26(21)27-24(35-17-25(32)34-2)15-20-11-6-7-12-22(20)28(27)31(23)16-19-9-4-3-5-10-19/h3-5,8-10,13-15H,1,6-7,11-12,16-17H2,2H3,(H2,30,33) |
| InChIKey | RYWTYJDPEJPZMM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|