C23H27F3N2O3 — CID 20769437
benzyl 4-[2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methylpiperazine-1-carboxylate (PubChem CID 20769437) has the molecular formula C23H27F3N2O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is benzyl 4-[2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 20769437 |
| Molecular Formula | C23H27F3N2O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | benzyl 4-[2-methoxy-1-[4-(trifluoromethyl)phenyl]ethyl]-3-methylpiperazine-1-carboxylate |
| SMILES | COCC(c1ccc(C(F)(F)F)cc1)N1CCN(C(=O)OCc2ccccc2)CC1C |
| InChI | InChI=1S/C23H27F3N2O3/c1-17-14-27(22(29)31-15-18-6-4-3-5-7-18)12-13-28(17)21(16-30-2)19-8-10-20(11-9-19)23(24,25)26/h3-11,17,21H,12-16H2,1-2H3 |
| InChIKey | ZRGYKZHSCZNLTM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |