About 2-ethoxy-1,3-di(propan-2-yl)benzene
2-ethoxy-1,3-di(propan-2-yl)benzene (PubChem CID 20769463) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-ethoxy-1,3-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 2-ethoxy-1,3-di(propan-2-yl)benzene |
| PubChem CID | 20769463 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-ethoxy-1,3-di(propan-2-yl)benzene |
| SMILES | CCOc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C14H22O/c1-6-15-14-12(10(2)3)8-7-9-13(14)11(4)5/h7-11H,6H2,1-5H3 |
| InChIKey | RPRVVDLULKXCLG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethoxy-1,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1,3-di(propan-2-yl)benzene?
The IUPAC name of 2-ethoxy-1,3-di(propan-2-yl)benzene (CID 20769463) is 2-ethoxy-1,3-di(propan-2-yl)benzene.
What is the SMILES notation for 2-ethoxy-1,3-di(propan-2-yl)benzene?
The canonical SMILES for 2-ethoxy-1,3-di(propan-2-yl)benzene is CCOc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of 2-ethoxy-1,3-di(propan-2-yl)benzene?
The InChIKey is RPRVVDLULKXCLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-6-15-14-12(10(2)3)8-7-9-13(14)11(4)5/h7-11H,6H2,1-5H3.
What are the key properties of 2-ethoxy-1,3-di(propan-2-yl)benzene?
2-ethoxy-1,3-di(propan-2-yl)benzene has a molecular weight of 206.33 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1,3-di(propan-2-yl)benzene is sourced from PubChem (CID 20769463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).