C7H14N2 — CID 20769495
N,N'-bis(prop-1-en-2-yl)methanediamine (PubChem CID 20769495) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is N,N'-bis(prop-1-en-2-yl)methanediamine.
| Compound Name | N,N'-bis(prop-1-en-2-yl)methanediamine |
|---|---|
| PubChem CID | 20769495 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N,N'-bis(prop-1-en-2-yl)methanediamine |
| SMILES | C=C(C)NCNC(=C)C |
| InChI | InChI=1S/C7H14N2/c1-6(2)8-5-9-7(3)4/h8-9H,1,3,5H2,2,4H3 |
| InChIKey | DOZPCESIMCPLLN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|