C13H15NO7S — CID 20769742
4-(3-methylsulfonylpropylcarbamoyl)phthalic acid (PubChem CID 20769742) has the molecular formula C13H15NO7S and a molecular weight of 329.33 g/mol. Its IUPAC name is 4-(3-methylsulfonylpropylcarbamoyl)phthalic acid.
| Compound Name | 4-(3-methylsulfonylpropylcarbamoyl)phthalic acid |
|---|---|
| PubChem CID | 20769742 |
| Molecular Formula | C13H15NO7S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-(3-methylsulfonylpropylcarbamoyl)phthalic acid |
| SMILES | CS(=O)(=O)CCCNC(=O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H15NO7S/c1-22(20,21)6-2-5-14-11(15)8-3-4-9(12(16)17)10(7-8)13(18)19/h3-4,7H,2,5-6H2,1H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | JSNKDOYATHQZOL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|