About methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite
methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite (PubChem CID 20769890) has the molecular formula C5H13NO5S2
and a molecular weight of 231.29 g/mol. Its IUPAC name is methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite.
Molecular Properties
| Compound Name | methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite |
| PubChem CID | 20769890 |
| Molecular Formula | C5H13NO5S2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite |
| SMILES | COS(=O)OCCN(C)S(C)(=O)=O |
| InChI | InChI=1S/C5H13NO5S2/c1-6(13(3,8)9)4-5-11-12(7)10-2/h4-5H2,1-3H3 |
| InChIKey | CGFJJPCEICQNIT-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite?
The IUPAC name of methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite (CID 20769890) is methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite.
What is the SMILES notation for methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite?
The canonical SMILES for methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite is COS(=O)OCCN(C)S(C)(=O)=O.
What is the InChIKey of methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite?
The InChIKey is CGFJJPCEICQNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO5S2/c1-6(13(3,8)9)4-5-11-12(7)10-2/h4-5H2,1-3H3.
What are the key properties of methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite?
methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite has a molecular weight of 231.29 g/mol, XLogP of -0.88, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[methyl(methylsulfonyl)amino]ethyl sulfite is sourced from PubChem (CID 20769890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).