C11H12F8 — CID 20770025
2,2-difluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]heptane (PubChem CID 20770025) has the molecular formula C11H12F8 and a molecular weight of 296.20 g/mol. Its IUPAC name is 2,2-difluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]heptane.
| Compound Name | 2,2-difluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20770025 |
| Molecular Formula | C11H12F8 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,2-difluoro-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)bicyclo[2.2.1]heptane |
| SMILES | CC(C1C2CCC(C2)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F8/c1-8(10(14,15)16,11(17,18)19)7-5-2-3-6(4-5)9(7,12)13/h5-7H,2-4H2,1H3 |
| InChIKey | YJNFSYIATCIULB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |