C19H29F3 — CID 20770051
4,5-dimethyl-9-(3,3,3-trifluoro-2,2-dimethylpropyl)tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 20770051) has the molecular formula C19H29F3 and a molecular weight of 314.44 g/mol. Its IUPAC name is 4,5-dimethyl-9-(3,3,3-trifluoro-2,2-dimethylpropyl)tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 4,5-dimethyl-9-(3,3,3-trifluoro-2,2-dimethylpropyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 20770051 |
| Molecular Formula | C19H29F3 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 4,5-dimethyl-9-(3,3,3-trifluoro-2,2-dimethylpropyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | CC1C(C)C2CC1C1C3CC(CC(C)(C)C(F)(F)F)C(C3)C21 |
| InChI | InChI=1S/C19H29F3/c1-9-10(2)14-7-13(9)16-11-5-12(15(6-11)17(14)16)8-18(3,4)19(20,21)22/h9-17H,5-8H2,1-4H3 |
| InChIKey | LZJSONVOUNMYNS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|