C18H25NO — CID 20770261
2-methyl-1-piperidin-1-yl-3-(4-prop-1-en-2-ylphenyl)propan-1-one (PubChem CID 20770261) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-methyl-1-piperidin-1-yl-3-(4-prop-1-en-2-ylphenyl)propan-1-one.
| Compound Name | 2-methyl-1-piperidin-1-yl-3-(4-prop-1-en-2-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 20770261 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-methyl-1-piperidin-1-yl-3-(4-prop-1-en-2-ylphenyl)propan-1-one |
| SMILES | C=C(C)c1ccc(CC(C)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25NO/c1-14(2)17-9-7-16(8-10-17)13-15(3)18(20)19-11-5-4-6-12-19/h7-10,15H,1,4-6,11-13H2,2-3H3 |
| InChIKey | IIHWFJBHSFHZHN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |