C17H13FN4O3S — CID 20770553
2-[5-[(4-fluorophenyl)methyl]-2-methylperoxysulfanylpyrrolo[2,3-b]pyrazin-6-yl]-1,3-oxazole (PubChem CID 20770553) has the molecular formula C17H13FN4O3S and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-[5-[(4-fluorophenyl)methyl]-2-methylperoxysulfanylpyrrolo[2,3-b]pyrazin-6-yl]-1,3-oxazole.
| Compound Name | 2-[5-[(4-fluorophenyl)methyl]-2-methylperoxysulfanylpyrrolo[2,3-b]pyrazin-6-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 20770553 |
| Molecular Formula | C17H13FN4O3S |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-[5-[(4-fluorophenyl)methyl]-2-methylperoxysulfanylpyrrolo[2,3-b]pyrazin-6-yl]-1,3-oxazole |
| SMILES | COOSc1cnc2c(cc(-c3ncco3)n2Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H13FN4O3S/c1-23-25-26-15-9-20-16-13(21-15)8-14(17-19-6-7-24-17)22(16)10-11-2-4-12(18)5-3-11/h2-9H,10H2,1H3 |
| InChIKey | ZZLGVXHZMWURFA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|