C13H15F2NO2 — CID 20770651
8-(2,4-difluorophenyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 20770651) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(2,4-difluorophenyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 20770651 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 8-(2,4-difluorophenyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | Fc1ccc(N2CCC3(CC2)OCCO3)c(F)c1 |
| InChI | InChI=1S/C13H15F2NO2/c14-10-1-2-12(11(15)9-10)16-5-3-13(4-6-16)17-7-8-18-13/h1-2,9H,3-8H2 |
| InChIKey | KKGQSDSVVXOSRM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |