C9H6F12 — CID 20771097
1,3-bis(1,1-difluoroethyl)-1,2,2,3,4,4,5,5-octafluorocyclopentane (PubChem CID 20771097) has the molecular formula C9H6F12 and a molecular weight of 342.12 g/mol. Its IUPAC name is 1,3-bis(1,1-difluoroethyl)-1,2,2,3,4,4,5,5-octafluorocyclopentane.
| Compound Name | 1,3-bis(1,1-difluoroethyl)-1,2,2,3,4,4,5,5-octafluorocyclopentane |
|---|---|
| PubChem CID | 20771097 |
| Molecular Formula | C9H6F12 |
| Molecular Weight | 342.12 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1,3-bis(1,1-difluoroethyl)-1,2,2,3,4,4,5,5-octafluorocyclopentane |
| SMILES | CC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(C(C)(F)F)C1(F)F |
| InChI | InChI=1S/C9H6F12/c1-3(10,11)5(14)7(16,17)6(15,4(2,12)13)9(20,21)8(5,18)19/h1-2H3 |
| InChIKey | ORVWDKJNTGETRJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.12 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|