C10H6F14 — CID 20771098
1,3-bis(1,1-difluoroethyl)-1,2,2,3,4,4,5-heptafluoro-5-(trifluoromethyl)cyclopentane (PubChem CID 20771098) has the molecular formula C10H6F14 and a molecular weight of 392.13 g/mol. Its IUPAC name is 1,3-bis(1,1-difluoroethyl)-1,2,2,3,4,4,5-heptafluoro-5-(trifluoromethyl)cyclopentane.
| Compound Name | 1,3-bis(1,1-difluoroethyl)-1,2,2,3,4,4,5-heptafluoro-5-(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 20771098 |
| Molecular Formula | C10H6F14 |
| Molecular Weight | 392.13 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 1,3-bis(1,1-difluoroethyl)-1,2,2,3,4,4,5-heptafluoro-5-(trifluoromethyl)cyclopentane |
| SMILES | CC(F)(F)C1(F)C(F)(F)C(F)(C(C)(F)F)C(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C10H6F14/c1-3(11,12)5(15)7(17,10(22,23)24)9(20,21)6(16,4(2,13)14)8(5,18)19/h1-2H3 |
| InChIKey | CLUUKVOXSDJAEQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.13 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |