About 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane
1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane (PubChem CID 20771099) has the molecular formula C11H16F6
and a molecular weight of 262.24 g/mol. Its IUPAC name is 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane.
Molecular Properties
| Compound Name | 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane |
| PubChem CID | 20771099 |
| Molecular Formula | C11H16F6 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane |
| SMILES | CCC1CC(CC)C(C(F)(F)F)C1C(F)(F)F |
| InChI | InChI=1S/C11H16F6/c1-3-6-5-7(4-2)9(11(15,16)17)8(6)10(12,13)14/h6-9H,3-5H2,1-2H3 |
| InChIKey | GTPHDKBXDIJTLO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane?
The IUPAC name of 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane (CID 20771099) is 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane.
What is the SMILES notation for 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane?
The canonical SMILES for 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane is CCC1CC(CC)C(C(F)(F)F)C1C(F)(F)F.
What is the InChIKey of 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane?
The InChIKey is GTPHDKBXDIJTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F6/c1-3-6-5-7(4-2)9(11(15,16)17)8(6)10(12,13)14/h6-9H,3-5H2,1-2H3.
What are the key properties of 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane?
1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane has a molecular weight of 262.24 g/mol, XLogP of 4.80, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethyl-2,3-bis(trifluoromethyl)cyclopentane is sourced from PubChem (CID 20771099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).