About 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid
2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid (PubChem CID 20771245) has the molecular formula C10H18O6S
and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid |
| PubChem CID | 20771245 |
| Molecular Formula | C10H18O6S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid |
| SMILES | CC1(C)OC(CC(=O)O)CC(CS(C)(=O)=O)O1 |
| InChI | InChI=1S/C10H18O6S/c1-10(2)15-7(5-9(11)12)4-8(16-10)6-17(3,13)14/h7-8H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | JMHYJPCUPXILQF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid?
The IUPAC name of 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid (CID 20771245) is 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid.
What is the SMILES notation for 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid?
The canonical SMILES for 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid is CC1(C)OC(CC(=O)O)CC(CS(C)(=O)=O)O1.
What is the InChIKey of 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid?
The InChIKey is JMHYJPCUPXILQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O6S/c1-10(2)15-7(5-9(11)12)4-8(16-10)6-17(3,13)14/h7-8H,4-6H2,1-3H3,(H,11,12).
What are the key properties of 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid?
2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid has a molecular weight of 266.31 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethyl-6-(methylsulfonylmethyl)-1,3-dioxan-4-yl]acetic acid is sourced from PubChem (CID 20771245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).