C21H32O2 — CID 20771668
cyclohexyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 20771668) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is cyclohexyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | cyclohexyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 20771668 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | cyclohexyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC1C(C)C2CC1C1C3CC(C(=O)OC4CCCCC4)C(C3)C21 |
| InChI | InChI=1S/C21H32O2/c1-11-12(2)16-10-15(11)19-13-8-17(20(16)19)18(9-13)21(22)23-14-6-4-3-5-7-14/h11-20H,3-10H2,1-2H3 |
| InChIKey | RVZLLBCCXPMBSU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|