C18H22F6O2 — CID 20771669
1,1,1,3,3,3-hexafluoropropan-2-yl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 20771669) has the molecular formula C18H22F6O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 20771669 |
| Molecular Formula | C18H22F6O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC1C(C)C2CC1C1C3CC(C(=O)OC(C(F)(F)F)C(F)(F)F)C(C3)C21 |
| InChI | InChI=1S/C18H22F6O2/c1-6-7(2)10-5-9(6)13-8-3-11(14(10)13)12(4-8)15(25)26-16(17(19,20)21)18(22,23)24/h6-14,16H,3-5H2,1-2H3 |
| InChIKey | ZOCUDYQNCBNBCW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|