C42H58O10 — CID 20771694
4-O-(2,2-dimethyl-5-oxooxolan-3-yl) 1-O-(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[2,5-dioxo-4-[2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)propan-2-yl]oxolan-3-yl]-2,3-dimethylbutanedioate (PubChem CID 20771694) has the molecular formula C42H58O10 and a molecular weight of 722.92 g/mol. Its IUPAC name is 4-O-(2,2-dimethyl-5-oxooxolan-3-yl) 1-O-(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[2,5-dioxo-4-[2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)propan-2-yl]oxolan-3-yl]-2,3-dimethylbutanedioate.
| Compound Name | 4-O-(2,2-dimethyl-5-oxooxolan-3-yl) 1-O-(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[2,5-dioxo-4-[2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)propan-2-yl]oxolan-3-yl]-2,3-dimethylbutanedioate |
|---|---|
| PubChem CID | 20771694 |
| Molecular Formula | C42H58O10 |
| Molecular Weight | 722.92 g/mol |
| Exact Mass | 722.40 |
| IUPAC Name | 4-O-(2,2-dimethyl-5-oxooxolan-3-yl) 1-O-(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2-[2,5-dioxo-4-[2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)propan-2-yl]oxolan-3-yl]-2,3-dimethylbutanedioate |
| SMILES | CC(C(=O)OC1CC(=O)OC1(C)C)C(C)(C(=O)OC1(C)CC2CC1C1CCCC21)C1C(=O)OC(=O)C1C(C)(C)OC1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C42H58O10/c1-19(35(44)48-29-17-30(43)51-39(29,2)3)42(7,38(47)52-41(6)18-23-15-27(41)25-10-8-9-24(23)25)34-33(36(45)49-37(34)46)40(4,5)50-28-16-22-14-26(28)32-21-12-11-20(13-21)31(22)32/h19-29,31-34H,8-18H2,1-7H3 |
| InChIKey | PEQOWSCYAJGBRM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.92 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|