C35H50O11 — CID 20771697
1-O-(2,2-dimethyl-5-oxooxolan-3-yl) 4-O-(1-ethoxyethyl) 3-[2,5-dioxo-4-[1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl]oxolan-3-yl]-2,2,3-trimethylbutanedioate (PubChem CID 20771697) has the molecular formula C35H50O11 and a molecular weight of 646.77 g/mol. Its IUPAC name is 1-O-(2,2-dimethyl-5-oxooxolan-3-yl) 4-O-(1-ethoxyethyl) 3-[2,5-dioxo-4-[1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl]oxolan-3-yl]-2,2,3-trimethylbutanedioate.
| Compound Name | 1-O-(2,2-dimethyl-5-oxooxolan-3-yl) 4-O-(1-ethoxyethyl) 3-[2,5-dioxo-4-[1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl]oxolan-3-yl]-2,2,3-trimethylbutanedioate |
|---|---|
| PubChem CID | 20771697 |
| Molecular Formula | C35H50O11 |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | 1-O-(2,2-dimethyl-5-oxooxolan-3-yl) 4-O-(1-ethoxyethyl) 3-[2,5-dioxo-4-[1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxy)ethyl]oxolan-3-yl]-2,2,3-trimethylbutanedioate |
| SMILES | CCOC(C)OC(=O)C(C)(C1C(=O)OC(=O)C1C(C)OC1CC2CC1C1C3CCC(C3)C21)C(C)(C)C(=O)OC1CC(=O)OC1(C)C |
| InChI | InChI=1S/C35H50O11/c1-9-41-17(3)43-32(40)35(8,33(4,5)31(39)44-23-15-24(36)46-34(23,6)7)28-25(29(37)45-30(28)38)16(2)42-22-14-20-13-21(22)27-19-11-10-18(12-19)26(20)27/h16-23,25-28H,9-15H2,1-8H3 |
| InChIKey | RKBCZWYLBWZHFX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|