About (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate
(1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 20771727) has the molecular formula C21H34O3
and a molecular weight of 334.50 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate |
| PubChem CID | 20771727 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | CCC1OC(CC)C2C3CC(CC3C(=O)OC3(CC)CCCC3)C12 |
| InChI | InChI=1S/C21H34O3/c1-4-16-18-13-11-14(19(18)17(5-2)23-16)15(12-13)20(22)24-21(6-3)9-7-8-10-21/h13-19H,4-12H2,1-3H3 |
| InChIKey | XUUNVPQBKFEFTQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate?
The IUPAC name of (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate (CID 20771727) is (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate.
What is the SMILES notation for (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate?
The canonical SMILES for (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate is CCC1OC(CC)C2C3CC(CC3C(=O)OC3(CC)CCCC3)C12.
What is the InChIKey of (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate?
The InChIKey is XUUNVPQBKFEFTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O3/c1-4-16-18-13-11-14(19(18)17(5-2)23-16)15(12-13)20(22)24-21(6-3)9-7-8-10-21/h13-19H,4-12H2,1-3H3.
What are the key properties of (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate?
(1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate has a molecular weight of 334.50 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 3,5-diethyl-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate is sourced from PubChem (CID 20771727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).