About N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline
N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline (PubChem CID 20771836) has the molecular formula C29H44N2
and a molecular weight of 420.69 g/mol. Its IUPAC name is N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline |
| PubChem CID | 20771836 |
| Molecular Formula | C29H44N2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)C(C)(C)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C29H44N2/c1-18(2)23-14-12-15-24(19(3)4)27(23)30-22(9)29(10,11)31-28-25(20(5)6)16-13-17-26(28)21(7)8/h12-21,31H,1-11H3/b30-22+ |
| InChIKey | WSEOJEXEYWDDAQ-JBASAIQMSA-N |
| XLogP | 9.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline?
The IUPAC name of N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline (CID 20771836) is N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline.
What is the SMILES notation for N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline?
The canonical SMILES for N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline is C/C(=N\c1c(C(C)C)cccc1C(C)C)C(C)(C)Nc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline?
The InChIKey is WSEOJEXEYWDDAQ-JBASAIQMSA-N. The full InChI is InChI=1S/C29H44N2/c1-18(2)23-14-12-15-24(19(3)4)27(23)30-22(9)29(10,11)31-28-25(20(5)6)16-13-17-26(28)21(7)8/h12-21,31H,1-11H3/b30-22+.
What are the key properties of N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline?
N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline has a molecular weight of 420.69 g/mol, XLogP of 9.16, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[2,6-di(propan-2-yl)phenyl]imino-2-methylbutan-2-yl]-2,6-di(propan-2-yl)aniline is sourced from PubChem (CID 20771836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).