About 9-(3-methylbutyl)purine
9-(3-methylbutyl)purine (PubChem CID 20771994) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 9-(3-methylbutyl)purine.
Molecular Properties
| Compound Name | 9-(3-methylbutyl)purine |
| PubChem CID | 20771994 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 9-(3-methylbutyl)purine |
| SMILES | CC(C)CCn1cnc2cncnc21 |
| InChI | InChI=1S/C10H14N4/c1-8(2)3-4-14-7-13-9-5-11-6-12-10(9)14/h5-8H,3-4H2,1-2H3 |
| InChIKey | MIBYXBBHOAJIHH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(3-methylbutyl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3-methylbutyl)purine?
The IUPAC name of 9-(3-methylbutyl)purine (CID 20771994) is 9-(3-methylbutyl)purine.
What is the SMILES notation for 9-(3-methylbutyl)purine?
The canonical SMILES for 9-(3-methylbutyl)purine is CC(C)CCn1cnc2cncnc21.
What is the InChIKey of 9-(3-methylbutyl)purine?
The InChIKey is MIBYXBBHOAJIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-8(2)3-4-14-7-13-9-5-11-6-12-10(9)14/h5-8H,3-4H2,1-2H3.
What are the key properties of 9-(3-methylbutyl)purine?
9-(3-methylbutyl)purine has a molecular weight of 190.25 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3-methylbutyl)purine is sourced from PubChem (CID 20771994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).