C20H18Cl2N6 — CID 20772113
N,N'-bis(4-chloroquinazolin-2-yl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 20772113) has the molecular formula C20H18Cl2N6 and a molecular weight of 413.31 g/mol. Its IUPAC name is N,N'-bis(4-chloroquinazolin-2-yl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis(4-chloroquinazolin-2-yl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 20772113 |
| Molecular Formula | C20H18Cl2N6 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N,N'-bis(4-chloroquinazolin-2-yl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN(C)c1nc(Cl)c2ccccc2n1)c1nc(Cl)c2ccccc2n1 |
| InChI | InChI=1S/C20H18Cl2N6/c1-27(19-23-15-9-5-3-7-13(15)17(21)25-19)11-12-28(2)20-24-16-10-6-4-8-14(16)18(22)26-20/h3-10H,11-12H2,1-2H3 |
| InChIKey | GLGYAYNJBPLKPH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |