About 8-methyl-4a,8a-dihydroquinoline
8-methyl-4a,8a-dihydroquinoline (PubChem CID 20772220) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 8-methyl-4a,8a-dihydroquinoline.
Molecular Properties
| Compound Name | 8-methyl-4a,8a-dihydroquinoline |
| PubChem CID | 20772220 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 8-methyl-4a,8a-dihydroquinoline |
| SMILES | CC1=CC=CC2C=CC=NC12 |
| InChI | InChI=1S/C10H11N/c1-8-4-2-5-9-6-3-7-11-10(8)9/h2-7,9-10H,1H3 |
| InChIKey | LNFNEQKLFJYCOQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methyl-4a,8a-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4a,8a-dihydroquinoline?
The IUPAC name of 8-methyl-4a,8a-dihydroquinoline (CID 20772220) is 8-methyl-4a,8a-dihydroquinoline.
What is the SMILES notation for 8-methyl-4a,8a-dihydroquinoline?
The canonical SMILES for 8-methyl-4a,8a-dihydroquinoline is CC1=CC=CC2C=CC=NC12.
What is the InChIKey of 8-methyl-4a,8a-dihydroquinoline?
The InChIKey is LNFNEQKLFJYCOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-8-4-2-5-9-6-3-7-11-10(8)9/h2-7,9-10H,1H3.
What are the key properties of 8-methyl-4a,8a-dihydroquinoline?
8-methyl-4a,8a-dihydroquinoline has a molecular weight of 145.20 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4a,8a-dihydroquinoline is sourced from PubChem (CID 20772220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).