C16H28N2 — CID 20773083
1,7-ditert-butyl-2,3,4,8-tetrahydro-1,7-naphthyridine (PubChem CID 20773083) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1,7-ditert-butyl-2,3,4,8-tetrahydro-1,7-naphthyridine.
| Compound Name | 1,7-ditert-butyl-2,3,4,8-tetrahydro-1,7-naphthyridine |
|---|---|
| PubChem CID | 20773083 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1,7-ditert-butyl-2,3,4,8-tetrahydro-1,7-naphthyridine |
| SMILES | CC(C)(C)N1C=CC2=C(C1)N(C(C)(C)C)CCC2 |
| InChI | InChI=1S/C16H28N2/c1-15(2,3)17-11-9-13-8-7-10-18(14(13)12-17)16(4,5)6/h9,11H,7-8,10,12H2,1-6H3 |
| InChIKey | YOGYPMGMAUKUKM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |