C16H24N2O2 — CID 20773084
1,7-ditert-butyl-2,3-dihydro-1,7-naphthyridine-4,8-dione (PubChem CID 20773084) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1,7-ditert-butyl-2,3-dihydro-1,7-naphthyridine-4,8-dione.
| Compound Name | 1,7-ditert-butyl-2,3-dihydro-1,7-naphthyridine-4,8-dione |
|---|---|
| PubChem CID | 20773084 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1,7-ditert-butyl-2,3-dihydro-1,7-naphthyridine-4,8-dione |
| SMILES | CC(C)(C)N1CCC(=O)c2ccn(C(C)(C)C)c(=O)c21 |
| InChI | InChI=1S/C16H24N2O2/c1-15(2,3)17-10-8-12(19)11-7-9-18(16(4,5)6)14(20)13(11)17/h7,9H,8,10H2,1-6H3 |
| InChIKey | WTIOSVKDVSBJHV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |