About 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine
3,4-ditert-butyl-1-methyl-2,7-dihydroazepine (PubChem CID 20773111) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine.
Molecular Properties
| Compound Name | 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine |
| PubChem CID | 20773111 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine |
| SMILES | CN1CC=CC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H27N/c1-14(2,3)12-9-8-10-16(7)11-13(12)15(4,5)6/h8-9H,10-11H2,1-7H3 |
| InChIKey | NUIGRBWIHLGFHI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine?
The IUPAC name of 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine (CID 20773111) is 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine.
What is the SMILES notation for 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine?
The canonical SMILES for 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine is CN1CC=CC(C(C)(C)C)=C(C(C)(C)C)C1.
What is the InChIKey of 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine?
The InChIKey is NUIGRBWIHLGFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-14(2,3)12-9-8-10-16(7)11-13(12)15(4,5)6/h8-9H,10-11H2,1-7H3.
What are the key properties of 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine?
3,4-ditert-butyl-1-methyl-2,7-dihydroazepine has a molecular weight of 221.39 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butyl-1-methyl-2,7-dihydroazepine is sourced from PubChem (CID 20773111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).