C15H26N2O — CID 20773179
4,6-ditert-butyl-3,5-dihydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 20773179) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 4,6-ditert-butyl-3,5-dihydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | 4,6-ditert-butyl-3,5-dihydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 20773179 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 4,6-ditert-butyl-3,5-dihydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | CC(C)(C)N1C=CC2=C(C1)N(C(C)(C)C)CCO2 |
| InChI | InChI=1S/C15H26N2O/c1-14(2,3)16-8-7-13-12(11-16)17(9-10-18-13)15(4,5)6/h7-8H,9-11H2,1-6H3 |
| InChIKey | HRAHHXBHUXNSIM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |