C15H27N3 — CID 20773186
4,6-ditert-butyl-1,2,3,5-tetrahydropyrido[3,4-b]pyrazine (PubChem CID 20773186) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 4,6-ditert-butyl-1,2,3,5-tetrahydropyrido[3,4-b]pyrazine.
| Compound Name | 4,6-ditert-butyl-1,2,3,5-tetrahydropyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 20773186 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 4,6-ditert-butyl-1,2,3,5-tetrahydropyrido[3,4-b]pyrazine |
| SMILES | CC(C)(C)N1C=CC2=C(C1)N(C(C)(C)C)CCN2 |
| InChI | InChI=1S/C15H27N3/c1-14(2,3)17-9-7-12-13(11-17)18(10-8-16-12)15(4,5)6/h7,9,16H,8,10-11H2,1-6H3 |
| InChIKey | RWIHWRGPTMQDHV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |