C15H26N2 — CID 20773197
1,6-ditert-butyl-3,7-dihydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 20773197) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1,6-ditert-butyl-3,7-dihydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | 1,6-ditert-butyl-3,7-dihydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 20773197 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1,6-ditert-butyl-3,7-dihydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CC(C)(C)N1C=CC2=C(C1)N(C(C)(C)C)CC2 |
| InChI | InChI=1S/C15H26N2/c1-14(2,3)16-9-7-12-8-10-17(13(12)11-16)15(4,5)6/h7,9H,8,10-11H2,1-6H3 |
| InChIKey | HECBPMHXCGINMY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |