C17H29NO2 — CID 20773209
6,7-ditert-butyl-4-propyl-3,4-dihydro-1H-azepine-2,5-dione (PubChem CID 20773209) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 6,7-ditert-butyl-4-propyl-3,4-dihydro-1H-azepine-2,5-dione.
| Compound Name | 6,7-ditert-butyl-4-propyl-3,4-dihydro-1H-azepine-2,5-dione |
|---|---|
| PubChem CID | 20773209 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 6,7-ditert-butyl-4-propyl-3,4-dihydro-1H-azepine-2,5-dione |
| SMILES | CCCC1CC(=O)NC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H29NO2/c1-8-9-11-10-12(19)18-15(17(5,6)7)13(14(11)20)16(2,3)4/h11H,8-10H2,1-7H3,(H,18,19) |
| InChIKey | JVNVEXQWZBGMGH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |