About CID 20773391
CID 20773391 (PubChem CID 20773391) has the molecular formula C12H25B2O4
and a molecular weight of 254.95 g/mol.
Molecular Properties
| Compound Name | CID 20773391 |
| PubChem CID | 20773391 |
| Molecular Formula | C12H25B2O4 |
| Molecular Weight | 254.95 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H25B2O4/c1-9(2,15)10(3,4)16-13-14-17-11(5,6)12(7,8)18-14/h15H,1-8H3 |
| InChIKey | SJSKHCBOCXHXBC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.95 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20773391 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20773391?
The IUPAC name of CID 20773391 (CID 20773391) is not available.
What is the SMILES notation for CID 20773391?
The canonical SMILES for CID 20773391 is CC(C)(O)C(C)(C)O[B]B1OC(C)(C)C(C)(C)O1.
What is the InChIKey of CID 20773391?
The InChIKey is SJSKHCBOCXHXBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25B2O4/c1-9(2,15)10(3,4)16-13-14-17-11(5,6)12(7,8)18-14/h15H,1-8H3.
What are the key properties of CID 20773391?
CID 20773391 has a molecular weight of 254.95 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20773391 is sourced from PubChem (CID 20773391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).